C17H27ClN4O3 — CID 111308486
2-[[[2-(4-chlorophenoxy)ethyl-methylamino]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 111308486) has the molecular formula C17H27ClN4O3 and a molecular weight of 370.88 g/mol. Its IUPAC name is 2-[[[2-(4-chlorophenoxy)ethyl-methylamino]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[[2-(4-chlorophenoxy)ethyl-methylamino]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111308486 |
| Molecular Formula | C17H27ClN4O3 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-[[[2-(4-chlorophenoxy)ethyl-methylamino]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)NCCOC)N(C)CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H27ClN4O3/c1-4-19-17(21-13-16(23)20-9-11-24-3)22(2)10-12-25-15-7-5-14(18)6-8-15/h5-8H,4,9-13H2,1-3H3,(H,19,21)(H,20,23) |
| InChIKey | XORWXVRISPAWDK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|