C14H24ClIN4O2S — CID 111363268
2-[[[(5-chlorothiophen-2-yl)methyl-methylamino]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111363268) has the molecular formula C14H24ClIN4O2S and a molecular weight of 474.80 g/mol. Its IUPAC name is 2-[[[(5-chlorothiophen-2-yl)methyl-methylamino]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[[[(5-chlorothiophen-2-yl)methyl-methylamino]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111363268 |
| Molecular Formula | C14H24ClIN4O2S |
| Molecular Weight | 474.80 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 2-[[[(5-chlorothiophen-2-yl)methyl-methylamino]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NCCOC)N(C)Cc1ccc(Cl)s1.I |
| InChI | InChI=1S/C14H23ClN4O2S.HI/c1-4-16-14(18-9-13(20)17-7-8-21-3)19(2)10-11-5-6-12(15)22-11;/h5-6H,4,7-10H2,1-3H3,(H,16,18)(H,17,20);1H |
| InChIKey | ZAJOLUKOBFYMPT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.80 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|