C12H21ClN4O2S2 — CID 111363191
1-[(5-chlorothiophen-2-yl)methyl]-3-ethyl-2-[2-(methanesulfonamido)ethyl]-1-methylguanidine (PubChem CID 111363191) has the molecular formula C12H21ClN4O2S2 and a molecular weight of 352.91 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-3-ethyl-2-[2-(methanesulfonamido)ethyl]-1-methylguanidine.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-ethyl-2-[2-(methanesulfonamido)ethyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111363191 |
| Molecular Formula | C12H21ClN4O2S2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-ethyl-2-[2-(methanesulfonamido)ethyl]-1-methylguanidine |
| SMILES | CCN/C(=N\CCNS(C)(=O)=O)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H21ClN4O2S2/c1-4-14-12(15-7-8-16-21(3,18)19)17(2)9-10-5-6-11(13)20-10/h5-6,16H,4,7-9H2,1-3H3,(H,14,15) |
| InChIKey | ASRVGZDRROIJOO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|