C15H25ClN4O2S2 — CID 109496336
2-[2-[(5-chlorothiophen-2-yl)sulfonylamino]ethyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine (PubChem CID 109496336) has the molecular formula C15H25ClN4O2S2 and a molecular weight of 392.98 g/mol. Its IUPAC name is 2-[2-[(5-chlorothiophen-2-yl)sulfonylamino]ethyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine.
| Compound Name | 2-[2-[(5-chlorothiophen-2-yl)sulfonylamino]ethyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109496336 |
| Molecular Formula | C15H25ClN4O2S2 |
| Molecular Weight | 392.98 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-[2-[(5-chlorothiophen-2-yl)sulfonylamino]ethyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N/CCNS(=O)(=O)c1ccc(Cl)s1)NCC |
| InChI | InChI=1S/C15H25ClN4O2S2/c1-4-6-7-12-20(3)15(17-5-2)18-10-11-19-24(21,22)14-9-8-13(16)23-14/h4,8-9,19H,1,5-7,10-12H2,2-3H3,(H,17,18) |
| InChIKey | FCLKQIATSAOCOT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.98 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|