C17H29IN4OS — CID 109496557
N-[3-[[ethylamino-[methyl(pent-4-enyl)amino]methylidene]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 109496557) has the molecular formula C17H29IN4OS and a molecular weight of 464.42 g/mol. Its IUPAC name is N-[3-[[ethylamino-[methyl(pent-4-enyl)amino]methylidene]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[ethylamino-[methyl(pent-4-enyl)amino]methylidene]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109496557 |
| Molecular Formula | C17H29IN4OS |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | N-[3-[[ethylamino-[methyl(pent-4-enyl)amino]methylidene]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/CCCNC(=O)c1cccs1)NCC.I |
| InChI | InChI=1S/C17H28N4OS.HI/c1-4-6-7-13-21(3)17(18-5-2)20-12-9-11-19-16(22)15-10-8-14-23-15;/h4,8,10,14H,1,5-7,9,11-13H2,2-3H3,(H,18,20)(H,19,22);1H |
| InChIKey | UDKZMTZCCAGMPY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|