C13H28N4O2S — CID 109496490
3-ethyl-2-[3-(methanesulfonamido)propyl]-1-methyl-1-pent-4-enylguanidine (PubChem CID 109496490) has the molecular formula C13H28N4O2S and a molecular weight of 304.46 g/mol. Its IUPAC name is 3-ethyl-2-[3-(methanesulfonamido)propyl]-1-methyl-1-pent-4-enylguanidine.
| Compound Name | 3-ethyl-2-[3-(methanesulfonamido)propyl]-1-methyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109496490 |
| Molecular Formula | C13H28N4O2S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 3-ethyl-2-[3-(methanesulfonamido)propyl]-1-methyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\CCCNS(C)(=O)=O)NCC |
| InChI | InChI=1S/C13H28N4O2S/c1-5-7-8-12-17(3)13(14-6-2)15-10-9-11-16-20(4,18)19/h5,16H,1,6-12H2,2-4H3,(H,14,15) |
| InChIKey | CIFSMFUMOZLGCG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|