C16H33N3O — CID 109484295
2-(3-ethoxypropyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine (PubChem CID 109484295) has the molecular formula C16H33N3O and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-(3-ethoxypropyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine.
| Compound Name | 2-(3-ethoxypropyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine |
|---|---|
| PubChem CID | 109484295 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | 2-(3-ethoxypropyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N\CCCOCC)NCC |
| InChI | InChI=1S/C16H33N3O/c1-5-8-9-10-11-14-19(4)16(17-6-2)18-13-12-15-20-7-3/h5H,1,6-15H2,2-4H3,(H,17,18) |
| InChIKey | QLSWIMBSOAYOOA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|