C17H28IN5O4S — CID 109497516
3-ethyl-1-methyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109497516) has the molecular formula C17H28IN5O4S and a molecular weight of 525.41 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109497516 |
| Molecular Formula | C17H28IN5O4S |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | 3-ethyl-1-methyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/CCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)NCC.I |
| InChI | InChI=1S/C17H27N5O4S.HI/c1-4-6-7-13-21(3)17(18-5-2)19-11-12-20-27(25,26)16-10-8-9-15(14-16)22(23)24;/h4,8-10,14,20H,1,5-7,11-13H2,2-3H3,(H,18,19);1H |
| InChIKey | DAOYCRCWFSTEEM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|