C14H24N6O2 — CID 109497906
3-ethyl-1-methyl-2-[2-(4-nitropyrazol-1-yl)ethyl]-1-pent-4-enylguanidine (PubChem CID 109497906) has the molecular formula C14H24N6O2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[2-(4-nitropyrazol-1-yl)ethyl]-1-pent-4-enylguanidine.
| Compound Name | 3-ethyl-1-methyl-2-[2-(4-nitropyrazol-1-yl)ethyl]-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109497906 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 3-ethyl-1-methyl-2-[2-(4-nitropyrazol-1-yl)ethyl]-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N/CCn1cc([N+](=O)[O-])cn1)NCC |
| InChI | InChI=1S/C14H24N6O2/c1-4-6-7-9-18(3)14(15-5-2)16-8-10-19-12-13(11-17-19)20(21)22/h4,11-12H,1,5-10H2,2-3H3,(H,15,16) |
| InChIKey | PQDOREACPLUTAM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|