C20H37N7O4 — CID 109412655
tert-butyl N-[1-[[N-ethyl-N'-[2-(4-nitropyrazol-1-yl)ethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate (PubChem CID 109412655) has the molecular formula C20H37N7O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is tert-butyl N-[1-[[N-ethyl-N'-[2-(4-nitropyrazol-1-yl)ethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[N-ethyl-N'-[2-(4-nitropyrazol-1-yl)ethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate |
|---|---|
| PubChem CID | 109412655 |
| Molecular Formula | C20H37N7O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | tert-butyl N-[1-[[N-ethyl-N'-[2-(4-nitropyrazol-1-yl)ethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate |
| SMILES | CCN/C(=N\CCn1cc([N+](=O)[O-])cn1)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C20H37N7O4/c1-8-21-18(22-10-12-26-14-16(13-23-26)27(29)30)25(7)11-9-17(15(2)3)24-19(28)31-20(4,5)6/h13-15,17H,8-12H2,1-7H3,(H,21,22)(H,24,28) |
| InChIKey | HIGRIPJOLSNYRX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|