C21H39N5O2S — CID 109412447
tert-butyl N-[1-[[N-ethyl-N'-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate (PubChem CID 109412447) has the molecular formula C21H39N5O2S and a molecular weight of 425.64 g/mol. Its IUPAC name is tert-butyl N-[1-[[N-ethyl-N'-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[N-ethyl-N'-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate |
|---|---|
| PubChem CID | 109412447 |
| Molecular Formula | C21H39N5O2S |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | tert-butyl N-[1-[[N-ethyl-N'-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate |
| SMILES | CCN/C(=N\CCc1ncc(C)s1)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C21H39N5O2S/c1-9-22-19(23-12-10-18-24-14-16(4)29-18)26(8)13-11-17(15(2)3)25-20(27)28-21(5,6)7/h14-15,17H,9-13H2,1-8H3,(H,22,23)(H,25,27) |
| InChIKey | JBGKBHXBGMIZPC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|