C20H41N5O4 — CID 109412460
tert-butyl N-[1-[[N-ethyl-N'-[2-(2-methoxyethylamino)-2-oxoethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate (PubChem CID 109412460) has the molecular formula C20H41N5O4 and a molecular weight of 415.58 g/mol. Its IUPAC name is tert-butyl N-[1-[[N-ethyl-N'-[2-(2-methoxyethylamino)-2-oxoethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[N-ethyl-N'-[2-(2-methoxyethylamino)-2-oxoethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate |
|---|---|
| PubChem CID | 109412460 |
| Molecular Formula | C20H41N5O4 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | tert-butyl N-[1-[[N-ethyl-N'-[2-(2-methoxyethylamino)-2-oxoethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate |
| SMILES | CCN/C(=N\CC(=O)NCCOC)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C20H41N5O4/c1-9-21-18(23-14-17(26)22-11-13-28-8)25(7)12-10-16(15(2)3)24-19(27)29-20(4,5)6/h15-16H,9-14H2,1-8H3,(H,21,23)(H,22,26)(H,24,27) |
| InChIKey | DFFQZLNINAGAAX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|