C21H42IN7O2 — CID 109412175
tert-butyl N-[1-[[N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide (PubChem CID 109412175) has the molecular formula C21H42IN7O2 and a molecular weight of 551.52 g/mol. Its IUPAC name is tert-butyl N-[1-[[N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[[N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109412175 |
| Molecular Formula | C21H42IN7O2 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | tert-butyl N-[1-[[N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCn1cnnc1CC)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C.I |
| InChI | InChI=1S/C21H41N7O2.HI/c1-9-18-26-24-15-28(18)14-12-23-19(22-10-2)27(8)13-11-17(16(3)4)25-20(29)30-21(5,6)7;/h15-17H,9-14H2,1-8H3,(H,22,23)(H,25,29);1H |
| InChIKey | FTPJYOYUIMRASJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|