C22H43IN6O2 — CID 109412871
tert-butyl N-[1-[[N-ethyl-N'-[3-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide (PubChem CID 109412871) has the molecular formula C22H43IN6O2 and a molecular weight of 550.53 g/mol. Its IUPAC name is tert-butyl N-[1-[[N-ethyl-N'-[3-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[[N-ethyl-N'-[3-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109412871 |
| Molecular Formula | C22H43IN6O2 |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | tert-butyl N-[1-[[N-ethyl-N'-[3-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCc1cnn(C)c1)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C.I |
| InChI | InChI=1S/C22H42N6O2.HI/c1-9-23-20(24-13-10-11-18-15-25-28(8)16-18)27(7)14-12-19(17(2)3)26-21(29)30-22(4,5)6;/h15-17,19H,9-14H2,1-8H3,(H,23,24)(H,26,29);1H |
| InChIKey | XHAIKVDZAVTRMK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|