C20H39IN6O2 — CID 109412964
tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]carbamimidoyl]amino]pentan-3-yl]carbamate;hydroiodide (PubChem CID 109412964) has the molecular formula C20H39IN6O2 and a molecular weight of 522.48 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]carbamimidoyl]amino]pentan-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]carbamimidoyl]amino]pentan-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109412964 |
| Molecular Formula | C20H39IN6O2 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]carbamimidoyl]amino]pentan-3-yl]carbamate;hydroiodide |
| SMILES | C/N=C(/NCCc1cnn(C)c1)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C.I |
| InChI | InChI=1S/C20H38N6O2.HI/c1-15(2)17(24-19(27)28-20(3,4)5)10-12-25(7)18(21-6)22-11-9-16-13-23-26(8)14-16;/h13-15,17H,9-12H2,1-8H3,(H,21,22)(H,24,27);1H |
| InChIKey | PFJBHQQTYGKHQH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|