C21H37N5O2 — CID 109413250
tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]pentan-3-yl]carbamate (PubChem CID 109413250) has the molecular formula C21H37N5O2 and a molecular weight of 391.56 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 109413250 |
| Molecular Formula | C21H37N5O2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]pentan-3-yl]carbamate |
| SMILES | C/N=C(/NCCc1ccccn1)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C21H37N5O2/c1-16(2)18(25-20(27)28-21(3,4)5)12-15-26(7)19(22-6)24-14-11-17-10-8-9-13-23-17/h8-10,13,16,18H,11-12,14-15H2,1-7H3,(H,22,24)(H,25,27) |
| InChIKey | DOLNLBVXWBGCMN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|