C18H39IN4O2S — CID 109412934
tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-(3-methylsulfanylpropyl)carbamimidoyl]amino]pentan-3-yl]carbamate;hydroiodide (PubChem CID 109412934) has the molecular formula C18H39IN4O2S and a molecular weight of 502.51 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-(3-methylsulfanylpropyl)carbamimidoyl]amino]pentan-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-(3-methylsulfanylpropyl)carbamimidoyl]amino]pentan-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109412934 |
| Molecular Formula | C18H39IN4O2S |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | tert-butyl N-[4-methyl-1-[methyl-[N'-methyl-N-(3-methylsulfanylpropyl)carbamimidoyl]amino]pentan-3-yl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCCSC)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C.I |
| InChI | InChI=1S/C18H38N4O2S.HI/c1-14(2)15(21-17(23)24-18(3,4)5)10-12-22(7)16(19-6)20-11-9-13-25-8;/h14-15H,9-13H2,1-8H3,(H,19,20)(H,21,23);1H |
| InChIKey | BJHGJMHDVCQUSU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|