C22H44IN5O2 — CID 109413132
tert-butyl N-[1-[[N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N'-methylcarbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide (PubChem CID 109413132) has the molecular formula C22H44IN5O2 and a molecular weight of 537.53 g/mol. Its IUPAC name is tert-butyl N-[1-[[N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N'-methylcarbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[[N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N'-methylcarbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109413132 |
| Molecular Formula | C22H44IN5O2 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | tert-butyl N-[1-[[N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N'-methylcarbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide |
| SMILES | C/N=C(/NCC1CCN(C2CC2)C1)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C.I |
| InChI | InChI=1S/C22H43N5O2.HI/c1-16(2)19(25-21(28)29-22(3,4)5)11-12-26(7)20(23-6)24-14-17-10-13-27(15-17)18-8-9-18;/h16-19H,8-15H2,1-7H3,(H,23,24)(H,25,28);1H |
| InChIKey | QWWQNTHYAVHYOG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|