C22H44IN5O4 — CID 110042742
tert-butyl N-[1-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxolan-3-ylmethyl)carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide (PubChem CID 110042742) has the molecular formula C22H44IN5O4 and a molecular weight of 569.53 g/mol. Its IUPAC name is tert-butyl N-[1-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxolan-3-ylmethyl)carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxolan-3-ylmethyl)carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110042742 |
| Molecular Formula | C22H44IN5O4 |
| Molecular Weight | 569.53 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | tert-butyl N-[1-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxolan-3-ylmethyl)carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide |
| SMILES | CC(C)C(CCN(C)/C(=N\CC(=O)N(C)C)NCC1CCOC1)NC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C22H43N5O4.HI/c1-16(2)18(25-21(29)31-22(3,4)5)9-11-27(8)20(24-14-19(28)26(6)7)23-13-17-10-12-30-15-17;/h16-18H,9-15H2,1-8H3,(H,23,24)(H,25,29);1H |
| InChIKey | IUAKLXPSYLXONK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|