C21H44IN5O3 — CID 109412710
tert-butyl N-[1-[[N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide (PubChem CID 109412710) has the molecular formula C21H44IN5O3 and a molecular weight of 541.52 g/mol. Its IUPAC name is tert-butyl N-[1-[[N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[[N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109412710 |
| Molecular Formula | C21H44IN5O3 |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | tert-butyl N-[1-[[N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CC1CN(C)CCO1)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C.I |
| InChI | InChI=1S/C21H43N5O3.HI/c1-9-22-19(23-14-17-15-25(7)12-13-28-17)26(8)11-10-18(16(2)3)24-20(27)29-21(4,5)6;/h16-18H,9-15H2,1-8H3,(H,22,23)(H,24,27);1H |
| InChIKey | GPVFVPWDWCJTCS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|