C16H33N5O2 — CID 111009779
N,N-diethyl-2-[[N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]-methylamino]acetamide (PubChem CID 111009779) has the molecular formula C16H33N5O2 and a molecular weight of 327.47 g/mol. Its IUPAC name is N,N-diethyl-2-[[N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]-methylamino]acetamide.
| Compound Name | N,N-diethyl-2-[[N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 111009779 |
| Molecular Formula | C16H33N5O2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | N,N-diethyl-2-[[N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]-methylamino]acetamide |
| SMILES | CCN/C(=N\CC1CN(C)CCO1)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C16H33N5O2/c1-6-17-16(18-11-14-12-19(4)9-10-23-14)20(5)13-15(22)21(7-2)8-3/h14H,6-13H2,1-5H3,(H,17,18) |
| InChIKey | BKTHGSZRYCGUGQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|