C21H43N5O3 — CID 109413184
tert-butyl N-[1-[[N-ethyl-N'-[3-oxo-3-(propan-2-ylamino)propyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate (PubChem CID 109413184) has the molecular formula C21H43N5O3 and a molecular weight of 413.61 g/mol. Its IUPAC name is tert-butyl N-[1-[[N-ethyl-N'-[3-oxo-3-(propan-2-ylamino)propyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[N-ethyl-N'-[3-oxo-3-(propan-2-ylamino)propyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate |
|---|---|
| PubChem CID | 109413184 |
| Molecular Formula | C21H43N5O3 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.34 |
| IUPAC Name | tert-butyl N-[1-[[N-ethyl-N'-[3-oxo-3-(propan-2-ylamino)propyl]carbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate |
| SMILES | CCN/C(=N\CCC(=O)NC(C)C)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C21H43N5O3/c1-10-22-19(23-13-11-18(27)24-16(4)5)26(9)14-12-17(15(2)3)25-20(28)29-21(6,7)8/h15-17H,10-14H2,1-9H3,(H,22,23)(H,24,27)(H,25,28) |
| InChIKey | DFKGILQJGNBFPY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|