C20H36F2N6O2 — CID 109412718
tert-butyl N-[1-[[N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethylcarbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate (PubChem CID 109412718) has the molecular formula C20H36F2N6O2 and a molecular weight of 430.54 g/mol. Its IUPAC name is tert-butyl N-[1-[[N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethylcarbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethylcarbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate |
|---|---|
| PubChem CID | 109412718 |
| Molecular Formula | C20H36F2N6O2 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | tert-butyl N-[1-[[N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethylcarbamimidoyl]-methylamino]-4-methylpentan-3-yl]carbamate |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)N(C)CCC(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C20H36F2N6O2/c1-8-23-18(25-13-16-24-10-12-28(16)17(21)22)27(7)11-9-15(14(2)3)26-19(29)30-20(4,5)6/h10,12,14-15,17H,8-9,11,13H2,1-7H3,(H,23,25)(H,26,29) |
| InChIKey | BLCFGBJPEZULDL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|