C17H31IN6O2 — CID 109490599
N-ethyl-3-methyl-N'-[2-(4-nitropyrazol-1-yl)ethyl]-3-propylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 109490599) has the molecular formula C17H31IN6O2 and a molecular weight of 478.38 g/mol. Its IUPAC name is N-ethyl-3-methyl-N'-[2-(4-nitropyrazol-1-yl)ethyl]-3-propylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-3-methyl-N'-[2-(4-nitropyrazol-1-yl)ethyl]-3-propylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109490599 |
| Molecular Formula | C17H31IN6O2 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-ethyl-3-methyl-N'-[2-(4-nitropyrazol-1-yl)ethyl]-3-propylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCCC1(C)CCCN(/C(=N/CCn2cc([N+](=O)[O-])cn2)NCC)C1.I |
| InChI | InChI=1S/C17H30N6O2.HI/c1-4-7-17(3)8-6-10-21(14-17)16(18-5-2)19-9-11-22-13-15(12-20-22)23(24)25;/h12-13H,4-11,14H2,1-3H3,(H,18,19);1H |
| InChIKey | FKWHQQCLJTXWMK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|