C17H33N3O — CID 109490488
N-ethyl-N'-[[1-(hydroxymethyl)cyclopropyl]methyl]-3-methyl-3-propylpiperidine-1-carboximidamide (PubChem CID 109490488) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is N-ethyl-N'-[[1-(hydroxymethyl)cyclopropyl]methyl]-3-methyl-3-propylpiperidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[1-(hydroxymethyl)cyclopropyl]methyl]-3-methyl-3-propylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109490488 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | N-ethyl-N'-[[1-(hydroxymethyl)cyclopropyl]methyl]-3-methyl-3-propylpiperidine-1-carboximidamide |
| SMILES | CCCC1(C)CCCN(/C(=N/CC2(CO)CC2)NCC)C1 |
| InChI | InChI=1S/C17H33N3O/c1-4-7-16(3)8-6-11-20(13-16)15(18-5-2)19-12-17(14-21)9-10-17/h21H,4-14H2,1-3H3,(H,18,19) |
| InChIKey | ZCQSPAFMYMIJNM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|