C21H44IN5 — CID 109490945
N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]-3-methyl-3-propylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 109490945) has the molecular formula C21H44IN5 and a molecular weight of 493.52 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]-3-methyl-3-propylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]-3-methyl-3-propylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109490945 |
| Molecular Formula | C21H44IN5 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]-3-methyl-3-propylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCCC1(C)CCCN(/C(=N/CC(C)N2CCN(CC)CC2)NCC)C1.I |
| InChI | InChI=1S/C21H43N5.HI/c1-6-10-21(5)11-9-12-26(18-21)20(22-7-2)23-17-19(4)25-15-13-24(8-3)14-16-25;/h19H,6-18H2,1-5H3,(H,22,23);1H |
| InChIKey | HUEWIEYLUAEUNN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|