C17H34IN3OS — CID 109490351
N-ethyl-N'-[(3-hydroxythiolan-3-yl)methyl]-3-methyl-3-propylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 109490351) has the molecular formula C17H34IN3OS and a molecular weight of 455.45 g/mol. Its IUPAC name is N-ethyl-N'-[(3-hydroxythiolan-3-yl)methyl]-3-methyl-3-propylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(3-hydroxythiolan-3-yl)methyl]-3-methyl-3-propylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109490351 |
| Molecular Formula | C17H34IN3OS |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-ethyl-N'-[(3-hydroxythiolan-3-yl)methyl]-3-methyl-3-propylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCCC1(C)CCCN(/C(=N/CC2(O)CCSC2)NCC)C1.I |
| InChI | InChI=1S/C17H33N3OS.HI/c1-4-7-16(3)8-6-10-20(13-16)15(18-5-2)19-12-17(21)9-11-22-14-17;/h21H,4-14H2,1-3H3,(H,18,19);1H |
| InChIKey | ZXTDHLILSAMKNI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|