C19H35IN6 — CID 109490677
N-ethyl-3-methyl-3-propyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109490677) has the molecular formula C19H35IN6 and a molecular weight of 474.44 g/mol. Its IUPAC name is N-ethyl-3-methyl-3-propyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-3-methyl-3-propyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109490677 |
| Molecular Formula | C19H35IN6 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | N-ethyl-3-methyl-3-propyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCCC1(C)CCCN(/C(=N/Cc2nnc3n2CCCC3)NCC)C1.I |
| InChI | InChI=1S/C19H34N6.HI/c1-4-10-19(3)11-8-12-24(15-19)18(20-5-2)21-14-17-23-22-16-9-6-7-13-25(16)17;/h4-15H2,1-3H3,(H,20,21);1H |
| InChIKey | UUSGCOOTUALGNA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|