C16H28N6S — CID 109486312
N,2-diethyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)thiomorpholine-4-carboximidamide (PubChem CID 109486312) has the molecular formula C16H28N6S and a molecular weight of 336.51 g/mol. Its IUPAC name is N,2-diethyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)thiomorpholine-4-carboximidamide.
| Compound Name | N,2-diethyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486312 |
| Molecular Formula | C16H28N6S |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | N,2-diethyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCC2)N1CCSC(CC)C1 |
| InChI | InChI=1S/C16H28N6S/c1-3-13-12-21(9-10-23-13)16(17-4-2)18-11-15-20-19-14-7-5-6-8-22(14)15/h13H,3-12H2,1-2H3,(H,17,18) |
| InChIKey | MJCIEGITGJNDCT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|