C18H33IN6S — CID 109485701
2-ethyl-N'-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109485701) has the molecular formula C18H33IN6S and a molecular weight of 492.48 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-ethyl-N'-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109485701 |
| Molecular Formula | C18H33IN6S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2-ethyl-N'-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N\C)NCCCc2nnc3n2CCCCC3)CCS1.I |
| InChI | InChI=1S/C18H32N6S.HI/c1-3-15-14-23(12-13-25-15)18(19-2)20-10-7-9-17-22-21-16-8-5-4-6-11-24(16)17;/h15H,3-14H2,1-2H3,(H,19,20);1H |
| InChIKey | KUWOASCTBWAEQK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|