C23H35ClIN7 — CID 111325635
4-[(4-chlorophenyl)methyl]-N'-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111325635) has the molecular formula C23H35ClIN7 and a molecular weight of 571.94 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-N'-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-[(4-chlorophenyl)methyl]-N'-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111325635 |
| Molecular Formula | C23H35ClIN7 |
| Molecular Weight | 571.94 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-N'-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCCc1nnc2n1CCCCC2)N1CCN(Cc2ccc(Cl)cc2)CC1.I |
| InChI | InChI=1S/C23H34ClN7.HI/c1-25-23(26-12-5-7-22-28-27-21-6-3-2-4-13-31(21)22)30-16-14-29(15-17-30)18-19-8-10-20(24)11-9-19;/h8-11H,2-7,12-18H2,1H3,(H,25,26);1H |
| InChIKey | COGGGTUTFVEPEQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.94 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|