C21H31ClIN7 — CID 111264222
4-(5-chloro-2-methylphenyl)-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111264222) has the molecular formula C21H31ClIN7 and a molecular weight of 543.89 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111264222 |
| Molecular Formula | C21H31ClIN7 |
| Molecular Weight | 543.89 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2n1CCCCC2)N1CCN(c2cc(Cl)ccc2C)CC1.I |
| InChI | InChI=1S/C21H30ClN7.HI/c1-16-7-8-17(22)14-18(16)27-10-12-28(13-11-27)21(23-2)24-15-20-26-25-19-6-4-3-5-9-29(19)20;/h7-8,14H,3-6,9-13,15H2,1-2H3,(H,23,24);1H |
| InChIKey | LIZJGPRPFADVLH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.89 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|