C20H29ClIN7 — CID 111186712
4-(3-chlorophenyl)-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111186712) has the molecular formula C20H29ClIN7 and a molecular weight of 529.86 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-chlorophenyl)-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111186712 |
| Molecular Formula | C20H29ClIN7 |
| Molecular Weight | 529.86 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 4-(3-chlorophenyl)-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2n1CCCCC2)N1CCN(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C20H28ClN7.HI/c1-22-20(23-15-19-25-24-18-8-3-2-4-9-28(18)19)27-12-10-26(11-13-27)17-7-5-6-16(21)14-17;/h5-7,14H,2-4,8-13,15H2,1H3,(H,22,23);1H |
| InChIKey | MWCGFWXTIMYMLN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.86 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|