C21H31N7O — CID 111242587
4-(4-methoxyphenyl)-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazine-1-carboximidamide (PubChem CID 111242587) has the molecular formula C21H31N7O and a molecular weight of 397.53 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(4-methoxyphenyl)-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111242587 |
| Molecular Formula | C21H31N7O |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 4-(4-methoxyphenyl)-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCc1nnc2n1CCCCC2)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C21H31N7O/c1-22-21(23-16-20-25-24-19-6-4-3-5-11-28(19)20)27-14-12-26(13-15-27)17-7-9-18(29-2)10-8-17/h7-10H,3-6,11-16H2,1-2H3,(H,22,23) |
| InChIKey | KBADQFUQFYLJDD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|