C24H37N7O — CID 111290457
N-ethyl-4-(3-methoxyphenyl)-N'-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111290457) has the molecular formula C24H37N7O and a molecular weight of 439.61 g/mol. Its IUPAC name is N-ethyl-4-(3-methoxyphenyl)-N'-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(3-methoxyphenyl)-N'-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111290457 |
| Molecular Formula | C24H37N7O |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.31 |
| IUPAC Name | N-ethyl-4-(3-methoxyphenyl)-N'-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCc1nnc2n1CCCCC2)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C24H37N7O/c1-3-25-24(26-13-8-12-23-28-27-22-11-5-4-6-14-31(22)23)30-17-15-29(16-18-30)20-9-7-10-21(19-20)32-2/h7,9-10,19H,3-6,8,11-18H2,1-2H3,(H,25,26) |
| InChIKey | RSZDSZWJNBSZQY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|