C18H24ClN7 — CID 109463318
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine (PubChem CID 109463318) has the molecular formula C18H24ClN7 and a molecular weight of 373.89 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109463318 |
| Molecular Formula | C18H24ClN7 |
| Molecular Weight | 373.89 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1nnc2n1CCC2)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C18H24ClN7/c1-20-18(21-11-17-24-23-16-6-3-8-26(16)17)22-14-7-9-25(12-14)15-5-2-4-13(19)10-15/h2,4-5,10,14H,3,6-9,11-12H2,1H3,(H2,20,21,22) |
| InChIKey | CVTHFICLZIEYKU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.89 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|