C18H24ClN5S — CID 109462580
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]-2-methylguanidine (PubChem CID 109462580) has the molecular formula C18H24ClN5S and a molecular weight of 377.95 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109462580 |
| Molecular Formula | C18H24ClN5S |
| Molecular Weight | 377.95 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[(2-ethyl-1,3-thiazol-4-yl)methyl]-2-methylguanidine |
| SMILES | CCc1nc(CN/C(=N\C)NC2CCN(c3cccc(Cl)c3)C2)cs1 |
| InChI | InChI=1S/C18H24ClN5S/c1-3-17-22-15(12-25-17)10-21-18(20-2)23-14-7-8-24(11-14)16-6-4-5-13(19)9-16/h4-6,9,12,14H,3,7-8,10-11H2,1-2H3,(H2,20,21,23) |
| InChIKey | QUOJQFFTNDUFGZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.95 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|