C21H29ClN6S — CID 109462838
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 109462838) has the molecular formula C21H29ClN6S and a molecular weight of 433.03 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109462838 |
| Molecular Formula | C21H29ClN6S |
| Molecular Weight | 433.03 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1csc(N2CCCC2)n1)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C21H29ClN6S/c1-23-20(24-9-7-18-15-29-21(26-18)27-10-2-3-11-27)25-17-8-12-28(14-17)19-6-4-5-16(22)13-19/h4-6,13,15,17H,2-3,7-12,14H2,1H3,(H2,23,24,25) |
| InChIKey | FUNWVINESLVQEH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.03 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|