C18H24ClF2IN6 — CID 111264316
4-(5-chloro-2-methylphenyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111264316) has the molecular formula C18H24ClF2IN6 and a molecular weight of 524.79 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111264316 |
| Molecular Formula | C18H24ClF2IN6 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1nccn1C(F)F)N1CCN(c2cc(Cl)ccc2C)CC1.I |
| InChI | InChI=1S/C18H23ClF2N6.HI/c1-13-3-4-14(19)11-15(13)25-7-9-26(10-8-25)18(22-2)24-12-16-23-5-6-27(16)17(20)21;/h3-6,11,17H,7-10,12H2,1-2H3,(H,22,24);1H |
| InChIKey | FWEWZIDGJGYNDC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|