C22H32N6 — CID 111723899
N'-methyl-3-phenyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]pyrrolidine-1-carboximidamide (PubChem CID 111723899) has the molecular formula C22H32N6 and a molecular weight of 380.54 g/mol. Its IUPAC name is N'-methyl-3-phenyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-phenyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111723899 |
| Molecular Formula | C22H32N6 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | N'-methyl-3-phenyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCCCc1nnc2n1CCCCC2)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C22H32N6/c1-23-22(27-16-13-19(17-27)18-9-4-2-5-10-18)24-14-8-12-21-26-25-20-11-6-3-7-15-28(20)21/h2,4-5,9-10,19H,3,6-8,11-17H2,1H3,(H,23,24) |
| InChIKey | ICCPQWLLOARNEN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|