C23H36IN7 — CID 110959978
4-benzyl-N'-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 110959978) has the molecular formula C23H36IN7 and a molecular weight of 537.49 g/mol. Its IUPAC name is 4-benzyl-N'-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-benzyl-N'-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110959978 |
| Molecular Formula | C23H36IN7 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 4-benzyl-N'-methyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCCc1nnc2n1CCCCC2)N1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C23H35N7.HI/c1-24-23(29-17-15-28(16-18-29)19-20-9-4-2-5-10-20)25-13-8-12-22-27-26-21-11-6-3-7-14-30(21)22;/h2,4-5,9-10H,3,6-8,11-19H2,1H3,(H,24,25);1H |
| InChIKey | JTRWSXFHUROGRD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|