C23H40N8O — CID 111419899
N'-methyl-4-(2-oxo-2-piperidin-1-ylethyl)-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111419899) has the molecular formula C23H40N8O and a molecular weight of 444.63 g/mol. Its IUPAC name is N'-methyl-4-(2-oxo-2-piperidin-1-ylethyl)-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(2-oxo-2-piperidin-1-ylethyl)-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111419899 |
| Molecular Formula | C23H40N8O |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.33 |
| IUPAC Name | N'-methyl-4-(2-oxo-2-piperidin-1-ylethyl)-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCCCc1nnc2n1CCCCC2)N1CCN(CC(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C23H40N8O/c1-24-23(25-11-8-10-21-27-26-20-9-4-2-7-14-31(20)21)30-17-15-28(16-18-30)19-22(32)29-12-5-3-6-13-29/h2-19H2,1H3,(H,24,25) |
| InChIKey | UOFLPLFUJKNACT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|