C18H32N8O — CID 111419855
N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide (PubChem CID 111419855) has the molecular formula C18H32N8O and a molecular weight of 376.51 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide.
| Compound Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111419855 |
| Molecular Formula | C18H32N8O |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nnc(C)n1C)N1CCN(CC(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C18H32N8O/c1-15-21-22-16(23(15)3)13-20-18(19-2)26-11-9-24(10-12-26)14-17(27)25-7-5-4-6-8-25/h4-14H2,1-3H3,(H,19,20) |
| InChIKey | UYSWGCCYQMZUFJ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|