C18H26ClN7 — CID 111325594
4-[(4-chlorophenyl)methyl]-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111325594) has the molecular formula C18H26ClN7 and a molecular weight of 375.91 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-[(4-chlorophenyl)methyl]-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111325594 |
| Molecular Formula | C18H26ClN7 |
| Molecular Weight | 375.91 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nnc(C)n1C)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H26ClN7/c1-14-22-23-17(24(14)3)12-21-18(20-2)26-10-8-25(9-11-26)13-15-4-6-16(19)7-5-15/h4-7H,8-13H2,1-3H3,(H,20,21) |
| InChIKey | DWRKIYSNVQGWFP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.91 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|