C23H35N7 — CID 111347562
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-[(4-propan-2-ylphenyl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide (PubChem CID 111347562) has the molecular formula C23H35N7 and a molecular weight of 409.58 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-[(4-propan-2-ylphenyl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-[(4-propan-2-ylphenyl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111347562 |
| Molecular Formula | C23H35N7 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-[(4-propan-2-ylphenyl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)N1CCN(Cc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H35N7/c1-6-11-24-23(25-16-22-27-26-19(4)28(22)5)30-14-12-29(13-15-30)17-20-7-9-21(10-8-20)18(2)3/h6-10,18H,1,11-17H2,2-5H3,(H,24,25) |
| InChIKey | IOJPUTNWZBBSEL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|