C18H28N8O — CID 111378434
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide (PubChem CID 111378434) has the molecular formula C18H28N8O and a molecular weight of 372.48 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111378434 |
| Molecular Formula | C18H28N8O |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)N1CCN(Cc2cc(C)on2)CC1 |
| InChI | InChI=1S/C18H28N8O/c1-5-6-19-18(20-12-17-22-21-15(3)24(17)4)26-9-7-25(8-10-26)13-16-11-14(2)27-23-16/h5,11H,1,6-10,12-13H2,2-4H3,(H,19,20) |
| InChIKey | BEELNHANGZJCGA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|