C15H27IN6O — CID 111737316
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(methoxymethyl)-N-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111737316) has the molecular formula C15H27IN6O and a molecular weight of 434.33 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(methoxymethyl)-N-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(methoxymethyl)-N-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111737316 |
| Molecular Formula | C15H27IN6O |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(methoxymethyl)-N-prop-2-enylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)N1CCC(COC)C1.I |
| InChI | InChI=1S/C15H26N6O.HI/c1-5-7-16-15(21-8-6-13(10-21)11-22-4)17-9-14-19-18-12(2)20(14)3;/h5,13H,1,6-11H2,2-4H3,(H,16,17);1H |
| InChIKey | JEGKKPTXHBZFOQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|