C22H34IN7O2 — CID 109387310
1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 109387310) has the molecular formula C22H34IN7O2 and a molecular weight of 555.47 g/mol. Its IUPAC name is 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109387310 |
| Molecular Formula | C22H34IN7O2 |
| Molecular Weight | 555.47 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 1-[1-(3,5-dimethoxyphenyl)piperidin-4-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)NC1CCN(c2cc(OC)cc(OC)c2)CC1.I |
| InChI | InChI=1S/C22H33N7O2.HI/c1-6-9-23-22(24-15-21-27-26-16(2)28(21)3)25-17-7-10-29(11-8-17)18-12-19(30-4)14-20(13-18)31-5;/h6,12-14,17H,1,7-11,15H2,2-5H3,(H2,23,24,25);1H |
| InChIKey | BWFOXCMFBBIKEM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|