C19H26BrN7 — CID 111922607
1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine (PubChem CID 111922607) has the molecular formula C19H26BrN7 and a molecular weight of 432.37 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine.
| Compound Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111922607 |
| Molecular Formula | C19H26BrN7 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)NC1CCN(c2ccccc2Br)C1 |
| InChI | InChI=1S/C19H26BrN7/c1-4-10-21-19(22-12-18-25-24-14(2)26(18)3)23-15-9-11-27(13-15)17-8-6-5-7-16(17)20/h4-8,15H,1,9-13H2,2-3H3,(H2,21,22,23) |
| InChIKey | BYMRXVWGXBEYIJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|