C18H24N6O — CID 111316196
1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine (PubChem CID 111316196) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111316196 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H24N6O/c1-4-10-19-18(20-12-17-23-22-13(2)24(17)3)21-15-9-11-25-16-8-6-5-7-14(15)16/h4-8,15H,1,9-12H2,2-3H3,(H2,19,20,21) |
| InChIKey | XSYQOFSVLZEORE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|